Dibutyl succinate Synonym: Tabutrex CAS Number 141-03-7 Linear Formula CH3(CH2)3OCOCH2CH2COO(CH2)3CH3 Molecular Weight 230.30 grade analytical standard form neat application(s) HPLC: suitable gas chromatography (GC): suitable format neat
FAQs of Dibutyl succinate:
Q: What is the purity level of Dibutyl succinate?
A: The purity level of Dibutyl succinate is 98%.
Q: What is the molecular formula of Dibutyl succinate?
A: The molecular formula of Dibutyl succinate is C8H14O4.
Q: What does Dibutyl succinate look like?
A: Dibutyl succinate appears as a colorless liquid.
Q: What is the molecular weight of Dibutyl succinate?
A: The molecular weight of Dibutyl succinate is 174.194 grams (g).
Q: What are the industrial applications of Dibutyl succinate?
A: Dibutyl succinate is used as a flavouring agent and has various industrial applications, including functional fluids (open systems), intermediates, paint additives and coating additives, pigment solvents, and viscosity adjustors.